S1RA 50mg
S1RA is a selective sigma-1 receptor antagonist, with a reported binding affinity of Ki = 17.0 ?? 7.0 nM, selective over the sigma-2 receptor and against a panel of other 170 receptors, enzymes, transporters and ion channels.
| Trivial name | S1RA 50mg |
| Catalog Number | A12504-50 |
| Alternative Name(s) | 4-(2-((5-methyl-1-(naphthalen-2-yl)-1H-pyrazol-3-yl)oxy)ethyl)morpholine |
| Molecular Formula | C20H23N3O2 |
| CAS# | 878141-96-9 |
| SMILES | CC1=CC(=NN1C2=CC3=CC=CC=C3C=C2)OCCN4CCOCC4 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/s1ra.html |
