µ-Conotoxin SIIIA | MedChemExpress (MCE)
μ-Conotoxin SIIIA is a tetrodotoxin (TTX)-resistant sodium channel blocker. μ-Conotoxin SIIIA is a toxic peptide that can be obtained from the venom of Conus snails. μ-Conotoxin SIIIA can be used in the study of neurological diseases, such as neuropathic pain[1].
| Trivial name | µ-Conotoxin SIIIA |
| Catalog Number | HY-P5858 |
| Research Area | Neurological Disease |
| CAS# | 877860-32-7 |
| Purity | ≥98.00% |
| SMILES | O=C1N(C(N[C@@H](CC(N)=O)C(NC(CSSC[C@H](NC2=O)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC(O)=O)C(N[C@@H](CC3=CNC=N3)C(N[C@@H](C)C(N[C@H]4CCCNC(N)=N)=O)=O)=O)=O)=O)C(N[C@@H](CSSC[C@@H]5NC4=O)C(N[C@@H](CC(N)=O)C(NCC(NCC(N[C@@H](CSSCC(NC5=O)C(N)=O)C(N[C@@H](CO)C(N[C@@H](CO)C(N[C@@H](CCCCN)C(N[C@H]2CC6=CNC7=CC=CC=C67)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)CCC1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/conotoxin-siiia.html |