Valproic Acid D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02947 |
| Alternative Name(s) | 2-(Propyl-3,3,3-D3)pentanoic-5,5,5-D3 Acid;2-(Propyl-3,3,3-d3)penecarboxylic Acid-d6; 44089-d6; DPA-d6; Depakine-d6; Dipropylacetic Acid-d6; Ergenyl-d6; Mylproin-d6; NSC 93819-d6; |
| Research Area | Antiepileptic; increases levels of -aminobutyric acid(GABA) in the brain. Anticonvulsant that also has efficacy as a mood stabilizer in bipolar disorder.;Labeled Valproic Acid, intended for use as an internal standard for the quantification of Valproic Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 87745-18-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(CCC([2H])([2H])[2H])CCC([2H])([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02947.html |
| Additional Information | NULL |