Valproic Acid D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-07048 |
| Alternative Name(s) | 2-(Propyl-2,2-D2)pentanoic-4,4-D2 Acid;2-(Propyl-2,2-d2)pentanoc-4,4-d2 cid |
| Research Area | Labeled Valproic Acid, intended for use as an internal standard for the quantification of Valproic Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 87745-17-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(C([2H])([2H])CC)C([2H])([2H])CC)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07048.html |
| Additional Information | NULL |