JNJ-26990990 | MedChemExpress (MCE)
JNJ-26990990 is a broad-spectrum antiepileptic agent with oral activity. JNJ-26990990 can inhibit voltage-gated Na+ channels and N-type Ca2+ channels, but has a very weak inhibitory effect on human carbonic anhydrase-II (IC50 = 110 μM)[1].
| Trivial name | JNJ-26990990 |
| Catalog Number | HY-12155 |
| Research Area | Neurological Disease |
| CAS# | 877316-38-6 |
| Purity | ≥98.0% |
| SMILES | O=S(N)(NCC1=CSC2=CC=CC=C21)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/jnj-26990990.html |