AR antagonist 6 | MedChemExpress (MCE)
AR antagonist 6 (compound 6i) is a diphenyl ether androgen receptor (AR) antagonist that binds AR at a concentration of 120 nM. AR antagonist 6 exhibits low toxicity and in vitro activity against the golden Syrian hamster ear model.[19][1].
| Trivial name | AR antagonist 6 |
| Catalog Number | HY-160680 |
| Research Area | Endocrinology |
| CAS# | 876760-08-6 |
| Purity | ≥98.0% |
| SMILES | N#CC1=CC=C(C=C1C(F)(F)F)OC2=C(OCC)C=CC=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ar-antagonist-6.html |