α-Conotoxin RgIA | MedChemExpress (MCE)
α-Conotoxin RgIA (α-RgIA) is a specific α9α10 nAChR antagonist. α-Conotoxin RgIA can be obtained from Conus regius venom. α-Conotoxin RgIA can be used in the study of neurological diseases[1].
| Trivial name | α-Conotoxin RgIA |
| Catalog Number | HY-P5845 |
| Alternative Name(s) | α-RgIA |
| Research Area | Neurological Disease |
| CAS# | 876728-23-3 |
| Purity | ≥98.00% |
| SMILES | O=C(CN)N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N1[C@H](C(N[C@H]2CCCNC(N)=N)=O)CCC1)=O)CC(O)=O)=O)CO)=O)CSSC[C@H](NC3=O)C(N[C@H](C(O)=O)CCCNC(N)=N)=O)=O)CSSC[C@H](NC2=O)C(N[C@H](C(N[C@H](C(N[C@H]3CCCNC(N)=N)=O)CC4=CC=C(O)C=C4)=O)CCCNC(N)=N)=O |
| PubChem Chemical Structure ID | 56679246 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-conotoxin-rgia.html |