NS8593 Hydrochloride
NS8593 is a potent negative gating inhibitor of small conductance Ca2+
-activated K+ channels (SK1-3 or Kca2.1-2.3 channels). NS8593 is also a potent inhibitor of the TRPM7 channel with an IC50 of 1.6 µM.
| Trivial name | N/A |
| Catalog Number | S6174 |
| Molecular Formula | C17H18ClN3 |
| CAS# | 875755-24-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | Cl.C1CC(NC2=NC3=CC=CC=C3[NH]2)C4=CC=CC=C4C1 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/ns8593-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6174-ns8593-hydrochloride-chemical-structure.gif |