Quisinostat (JNJ-26481585) 2HCl
Quisinostat (JNJ-26481585) 2HCl is a novel second-generation HDAC inhibitor with highest potency for HDAC1 with IC50 of 0.11 nM in a cell-free assay, modest potent to HDACs 2, 4, 10, and 11; greater than 30-fold selectivity against HDACs 3, 5, 8, and 9 and lowest potency to HDACs 6 and 7. Phase 2.
| Trivial name | N/A |
| Catalog Number | S1096 |
| Molecular Formula | C6H8O2 |
| CAS# | 875320-31-3 |
| Inchi | InChI=1S/C6H8O2/c1-4-3-6(7)5(2)8-4/h3,5H,1-2H3 |
| Inchi Key | ASOSVCXGWPDUGN-UHFFFAOYSA-N |
| SMILES | CC1C(=O)C=C(O1)C |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/JNJ-26481585.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s1096-jnj26481585-chemical-structure-s1096.gif |