(1S)-1,4-Anhydro-1-C-(2,4-difluoro-5-methylphenyl)-D-ribitol | MedChemExpress (MCE)
(1S)-1,4-Anhydro-1-C-(2,4-difluoro-5-methylphenyl)-D-ribitol is a purine nucleoside analogue. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1].
| Trivial name | (1S)-1,4-Anhydro-1-C-(2,4-difluoro-5-methylphenyl)-D-ribitol |
| Catalog Number | HY-152305 |
| Research Area | Others |
| CAS# | 875302-27-5 |
| Purity | ≥98.00% |
| SMILES | O[C@H]1[C@@H](O)[C@H](C2=C(F)C=C(F)C(C)=C2)O[C@@H]1CO |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/1s-1-4-anhydro-1-c-2-4-difluoro-5-methylphenyl-d-ribitol.html |