LY 2183240 10mg
LY 2183240 acts both as a potent inhibitor of the reuptake of the endocannabinoid anandamide, and as an inhibitor of fatty acid amide hydrolase (FAAH), the primary enzyme responsible for degrading anandamide.
| Trivial name | LY 2183240 10mg |
| Catalog Number | A11960-10 |
| Alternative Name(s) | 5-[(1,1'-Biphenyl]-4-yl)methyl]-N,N-dimethyl-1H-tetrazole-1-carboxamide |
| Molecular Formula | C17H17N5O |
| CAS# | 874902-19-9 |
| SMILES | CN(C)C(=O)N1C(=NN=N1)CC2=CC=C(C=C2)C3=CC=CC=C3 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/ly-2183240.html |
