Liriope Muscari Baily Saponins C
Liriope muscari baily saponins C, a natural product isolated and purified from the roots of Liriope muscari, has an anti-thrombotic activity due to down-regulation of the increased mRNA expression levels of IL-6 and TF.
| Trivial name | Liriope Muscari Baily Saponins-C |
| Catalog Number | CSN19957 |
| Alternative Name(s) | Liriope Muscari Baily Saponins-C |
| Research Area | / |
| Molecular Formula | C44H70O16 |
| CAS# | 87480-46-4 |
| Purity | ≥98% |
| SMILES | O[C@H]1[C@H](O[C@H]2[C@H](O[C@@H]3CC4=CC[C@@]5([H])[C@]6([H])C[C@]7([H])O[C@]8(CC[C@H](C)CO8)[C@@H](C)[C@]7([H])[C@@]6(C)CC[C@]5([H])[C@@]4(C)CC3)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]9[C@H](O)[C@@H](O)[C@H](O)CO9)O[C@@H](C)[C@H](O)[C@H]1O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/liriope-muscari-baily-saponins-c.html |