XL647 50mg
XL647 is an orally bioavailable small-molecule RTK inhibitor that binds to and inhibits several tyrosine receptor kinases that play major roles in tumor cell proliferation and tumor vascularization, including EGFR, HER2, ERBB2, VEGFR and EphB4.
| Trivial name | XL647 50mg |
| Catalog Number | A11057-50 |
| Alternative Name(s) | N-(3,4-dichloro-2-fluorophenyl)-6-methoxy-7-(((3aR,6aS)-2-methyloctahydrocyclopenta[c]pyrrol-5-yl)methoxy)quinazolin-4-amine |
| Molecular Formula | C24H25Cl2FN4O2 |
| CAS# | 874286-84-7 |
| SMILES | CN1CCCC(CCC1)COC2=C(C=C3C(=C2)N=CN=C3NC4=CC(=C(C(=C4)Cl)Cl)F)OC |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/xl647.html |
