2-[(2-Aminophenyl)amino]-5-methyl-3-thiophenecarbonitrile
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-03247 |
| Alternative Name(s) | Olanzapine Impurity ;2-(2-Aminoanilino)-5-methylthiophene-3-carbonitrile;2-(2-Aminoanilino)-5-methylthiophene-3-carbonitrile;2-((2-aminophenyl)amino)-5-methylthiophene-3-carbonitrile |
| Research Area | An impurity of Olanzapine; Impurity in commercial preparations of Olanzapine |
| Molecular Formula | NULL |
| CAS# | 873895-41-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC1=C(C=CC=C1)NC(SC(C)=C2)=C2C#N |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST03247.html |
| Additional Information | NULL |