Ramipril
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02262 |
| Alternative Name(s) | Rec; Delix;(2S,3aS,6aS)-1-((S)-2-(((S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino)propanoyta[b]pyrrole-2-carboxylic acid. |
| Research Area | Ramipril is a prodrug and nonsulfhydryl angiotensin converting enzyme (ACE) inhibitor with antihypertensive activity. Ramipril is converted in the liver by de-esterification into its active form ramiprilat, which inhibits ACE, thereby blocking the convers |
| Molecular Formula | NULL |
| CAS# | 87333-19-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1[C@](CCC2)([H])[C@]2([H])C[C@H]1C(O)=O)[C@H](C)N[C@H](C(OCC)=O)CCC3=CC=CC=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02262.html |
| Additional Information | NULL |
