Glycopyrrolate Iodide D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03091 |
| Alternative Name(s) | 3y]-1-methyl-1-(methyl-d3)-pyrrolidinium Iodide; |
| Research Area | A novel pharmaceutical compound based on PDE IV inhibitors; used in the treatment of respiratory complaints.;Labeled Glycopyrrolate, intended for use as an internal standard for the quantification of Glycopyrrolate by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H25D3INO3 |
| CAS# | 873295-32-0(Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1CCCC1)(C2=CC=CC=C2)C(OC3C[N+](C)(C([2H])([2H])[2H])CC3)=O.[I-] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03091.html |
| Additional Information | NULL |