IKK-16 10mM * 1mL in DMSO
IKK 16 is a selective I??B kinase (IKK) inhibitor for IKK-2, IKK complex and IKK-1 with IC50 of 40 nM, 70 nM and 200 nM, respectively.
| Trivial name | IKK-16 10mM * 1mL in DMSO |
| Catalog Number | A12836-10mM-D |
| Alternative Name(s) | Piperidine,1-[4-[(4-benzo[b]thien-2-yl-2-pyrimidinyl)amino]benzoyl]-4-(1-pyrrolidinyl) |
| Molecular Formula | C28H29N5OS |
| CAS# | 873225-46-8 |
| SMILES | C1CCN(C1)C2CCN(CC2)C(=O)C3=CC=C(C=C3)NC4=NC=CC(=N4)C5=CC6=CC=CC=C6S5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ikk-16.html |