Dabigatran etexilate mesylate 5mg
Dabigatran etexilate mesylate is the orally active prodrug of dabigatran. Dabigatran is a reversible and selective, direct thrombin inhibitor (DTI) with Ki value of 4.5 nM.
| Trivial name | Dabigatran etexilate mesylate 5mg |
| Catalog Number | A15057-5 |
| Alternative Name(s) | ethyl 3-[[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;methanesulfonic acid |
| Molecular Formula | C35H45N7O8S |
| CAS# | 872728-81-9 |
| SMILES | CCCCCCOC(=O)N=C(C1=CC=C(C=C1)NCC2=NC3=C(N2C)C=CC(=C3)C(=O)N(CCC(=O)OCC)C4=CC=CC=N4)N.CS(=O)(=O)O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/dabigatran-etexilate-mesylate.html |
