BGJ398 (NVP-BGJ398) 5mg
BGJ398 is a potent and selective inhibitor with potential antiangiogenic and antineoplastic activities of fibroblast growth factor receptor (FGFR) tyrosine kinases 1, 2, 3 and 4 (with IC50 values of 0.9, 1.4, 1.0 and 60 nM for FGFR1, FGFR2, FGFR3, and FGFR4 respectively).
| Trivial name | BGJ398 (NVP-BGJ398) 5mg |
| Catalog Number | A11159-5 |
| Alternative Name(s) | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(6-((4-(4-ethylpiperazin-1-yl)phenyl)amino)pyrimidin-4-yl)-1-methylurea |
| Molecular Formula | C26H31Cl2N7O3 |
| CAS# | 872511-34-7 |
| SMILES | CCN1CCN(CC1)C2=CC=C(C=C2)NC3=CC(=NC=N3)N(C)C(=O)NC4=C(C(=CC(=C4Cl)OC)OC)Cl |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/bgj398-nvp-bgj398.html |
