Emedastine
Emedastine is a potent, high affinity histamine H1-receptor-selective antagonist with Ki of 1.3 ±0.1 nM for H1-receptors while considerably weaker at H2- (K1 = 49,067 ± 11,113 nM) and H3-receptors (Ki = 12,430 ± 1,282 nM).
| Trivial name | N/A |
| Catalog Number | S5659 |
| Molecular Formula | C13H8N4OS |
| CAS# | 87233-61-2 |
| SMILES | C1=CC2=C(C3=C1NC(=O)C3=CC4=CN=CN4)SC=N2 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/emedastine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/emedastine-chemical-structure-s5659.gif |