LY81067 | MedChemExpress (MCE)
LY81067, a diaryltriazine, effectively protects against Pentylenetetrazole- and Picrotoxin-induced convulsions in mice. LY81067 exerts its anticonvulsant effects by binding to or near Picrotoxin (HY-101391) binding sites[1].
| Trivial name | LY81067 |
| Catalog Number | HY-119105 |
| Research Area | Neurological Disease |
| CAS# | 87186-60-5 |
| Purity | ≥98.00% |
| SMILES | OC1CCN(CC1)C2=NC(C3=CC=C(C=C3)C)=C(N=N2)C4=CC=C(C=C4)C |
| PubChem Chemical Structure ID | 135892 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ly81067.html |