TAK-285 10mM * 1mL in DMSO
TAK-285 is an investigational HER2/EGFR inhibitor that penetrates the CNS in Rats with an Intact Blood Brain Barrier (BBB).
| Trivial name | TAK-285 10mM * 1mL in DMSO |
| Catalog Number | A11236-10mM-D |
| Alternative Name(s) | N-(2-(4-((3-chloro-4-(3-(trifluoromethyl)phenoxy)phenyl)amino)-5H-pyrrolo[3,2-d]pyrimidin-5-yl)ethyl)-3-hydroxy-3-methylbutanamide |
| Molecular Formula | C26H25ClF3N5O3 |
| CAS# | 871026-44-7 |
| SMILES | CC(C)(CC(=O)NCCN1C=CC2=C1C(=NC=N2)NC3=CC(=C(C=C3)OC4=CC=CC(=C4)C(F)(F)F)Cl)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tak-285.html |
