Letaxaban (TAK-442) 10mg
Letaxaban, also known as TAK-442, is a potent, selective, and orally active factor Xa inhibitor, which is a tetrahydropyrimidin-2(1H)-one derivative. TAK-442 inhibited endogenous FXa activity in platelet-poor human [half-maximal inhibitory concentration (IC(50)): 53 nM, TAK-442] and rat (IC(50): 32 nM, TAK-442) plasma.
| Trivial name | Letaxaban (TAK-442) 10mg |
| Catalog Number | A12871-10 |
| Alternative Name(s) | (S)-1-(1-(3-((6-chloronaphthalen-2-yl)sulfonyl)-2-hydroxypropanoyl)piperidin-4-yl)tetrahydropyrimidin-2(1H)-one |
| Molecular Formula | C22H26ClN3O5S |
| CAS# | 870262-90-1 |
| SMILES | C1CNC(=O)N(C1)C2CCN(CC2)C(=O)[C@@H](CS(=O)(=O)C3=CC4=C(C=C3)C=C(C=C4)Cl)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/letaxaban-tak-442.html |
