Trichloroisocyanuric acid
Trichloroisocyanuric acid (TCCA) is a safe and efficient reagent, useful for chlorination and oxidation reactions.This product is a hazardous chemical (acute toxicity/flammable/skin corrosive). Please use it while wearing a protective face mask, gloves, and clothing.
| Trivial name | N/A |
| Catalog Number | S3632 |
| Molecular Formula | C3Cl3N3O3 |
| CAS# | 87-90-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/trichloroisocyanuric-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/trichloroisocyanuric-acid-chemical-structure-s3632.gif |