L-Arabinopyranose
L-Arabinopyranose selectively affects the invertase in small intestine, thereby inhibiting the absorption of sucrose, it is a kind of L-monosaccharide isolated from a colloid secreted by Arab trees.
| Trivial name | / |
| Catalog Number | CSN23628 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C5H10O5 |
| CAS# | 87-72-9 |
| Purity | ≥98% |
| SMILES | OC1[C@H](O)[C@@H](O)[C@@H](O)CO1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/l-arabinopyranose.html |
