Tartaric acid
Tartaric acid is a white crystalline organic acid that occurs naturally in many plants, most notably in grapes. It has several applications for industrial and pharmaceutical use.
| Trivial name | L-(+)-Tartaric acid |
| Catalog Number | CSN25196 |
| Alternative Name(s) | L-(+)-Tartaric acid |
| Research Area | / |
| Molecular Formula | C4H6O6 |
| CAS# | 87-69-4 |
| Purity | ≥98% |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(O)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/tartaric-acid.html |