Choline Bitartrate
Choline bitartrate is a form of the nutrient choline which is found in foods. Choline is necessary for normal liver and kidney function and a component of the neurotransmitter acetylcholine, a chemical that facilitates communication between the nerves and muscles.
| Trivial name | 2-Hydroxyethyl(trimethyl)azanium; 2; 3; 4-Trihydroxy-4-Oxobutanoate |
| Catalog Number | CSN18650 |
| Alternative Name(s) | 2-Hydroxyethyl(trimethyl)azanium; 2; 3; 4-Trihydroxy-4-Oxobutanoate |
| Research Area | / |
| Molecular Formula | C9H19NO7 |
| CAS# | 87-67-2 |
| Purity | ≥98% |
| SMILES | OCC[N+](C)(C)C.[O-]C(C(C(C(O)=O)O)O)=O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/choline-bitartrate.html |