K00135 | MedChemExpress (MCE)
K00135 is a potent and selective inhibitor of PIM kinases. K00135 inhibits survival and clonogenic growth of acute leukemia cells. K00135 inhibits the phosphorylation of PIM downstream targets[1].
| Trivial name | K00135 |
| Catalog Number | HY-123141 |
| Research Area | Cancer |
| CAS# | 869650-21-5 |
| Purity | ≥98.00% |
| SMILES | CC(C1=CC=CC(C2=CN=C3C=CC(NCC4CC4)=NN32)=C1)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/k00135.html |