OSI-906 10mM * 1mL in DMSO
OSI-906 is a potential first-in-class selective small molecule, dual kinase inhibitor of both insulin-like growth factor-1 receptor (IGF-1R) and insulin receptor (IR).
Trivial name | OSI-906 10mM * 1mL in DMSO |
Catalog Number | A11053-10mM-D |
Alternative Name(s) | cis-3-[8-Amino-1-(2-phenyl-7-quinolinyl)imidazo[1,5-a]pyrazin-3-yl]-1-methylcyclobutanol |
Molecular Formula | C26H23N5O |
CAS# | 867160-71-2 |
SMILES | CC1(CC(C1)C2=NC(=C3N2C=CN=C3N)C4=CC5=C(C=C4)C=CC(=N5)C6=CC=CC=C6)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/osi-906.html |