Tideglusib
non-ATP-competitive GSK-3β inhibitor PI3K/Akt/mTOR Signaling|GSK-3
| Catalog Number | B1539-5 |
| Research Area | PI3K/Akt/mTOR Signaling|GSK-3 |
| Molecular Formula | C19H14N2O2S |
| CAS# | 865854-05-3 |
| Purity | 98.45% |
| SMILES | C1=CC=C(C=C1)CN2C(=O)N(SC2=O)C3=CC=CC4=CC=CC=C43 |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1539 |
