Resminostat 25mg
Resminostat, also known as RAS2410, is a potent inhibitor of histone deacetylase (HDAC) classes I and II. It binds to and inhibits HDACs leading to an accumulation of highly acetylated histones.
| Trivial name | Resminostat 25mg |
| Catalog Number | A12556-25 |
| Alternative Name(s) | (E)-3-(1-((4-((dimethylamino)methyl)phenyl)sulfonyl)-1H-pyrrol-3-yl)-N-hydroxyacrylamide |
| Molecular Formula | C16H19N3O4S |
| CAS# | 864814-88-0 |
| SMILES | CN(C)CC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)/C=C/C(=O)NO |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/resminostat.html |