Empagliflozin 10mM * 1mL in DMSO
Empagliflozin is a potent, selective sodium glucose co-transporter-2 inhibitor that is in development for the treatment of type 2 diabetes.
| Trivial name | Empagliflozin 10mM * 1mL in DMSO |
| Catalog Number | A12440-10mM-D |
| Alternative Name(s) | (1S)-1,5-Anhydro-1-C-[4-chloro-3-[[4-[[(3S)-tetrahydro-3-furanyl]oxy]phenyl]methyl]phenyl]-D-glucitol |
| Molecular Formula | C23H27ClO7 |
| CAS# | 864070-44-0 |
| SMILES | C1COC[C@H]1OC2=CC=C(C=C2)CC3=C(C=CC(=C3)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/empagliflozin.html |
