McMMAF (GMP) | MedChemExpress (MCE)
McMMAF GMP is a GMP grade McMMAF (HY-15578). McMMAF is a protective group (maleimidocaproyl)-conjugated MMAF, which is a potent tubulin polymerization inhibitor. McMMAF can be used as a agent-linker for antibody-drug conjugates (ADC). McMMAF is uncleavable, and must be internalized and degraded within a cell, releasing cysteine-McMMAF as the active agent[1][2].
| Trivial name | McMMAF (GMP) |
| Catalog Number | HY-15578G |
| Alternative Name(s) | Maleimidocaproyl monomethylauristatin F (GMP) |
| Research Area | Cancer |
| CAS# | 863971-19-1 |
| Purity | ≥98.00% |
| SMILES | O=C([C@H](C)[C@H]([C@]1([H])CCCN1C(C[C@@H](OC)[C@@]([H])(N(C([C@H](C(C)C)NC([C@H](C(C)C)N(C)C(CCCCCN2C(C=CC2=O)=O)=O)=O)=O)C)[C@@H](C)CC)=O)OC)N[C@H](C(O)=O)CC3=CC=CC=C3 |
| PubChem Chemical Structure ID | 56949327 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mcmmaf-gmp.html |