1-[2-(2,4-Difluorophenyl)-2,3-epoxypropyl]-1H-1,2,4-triazole
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-18422 |
| Alternative Name(s) | 1-[[2-(2,4-Difluorophenyl)oxiranyl]methyl]-1H-1,2,4-triazole;1-((2-(2,4-difluorophenyl)oxiran-2-yl)methyl)-1H-1,2,4-triazole; Fluconazole EP Impurity G |
| Research Area | 1-[2-(2,4-Difluorophenyl)-2,3-epoxypropyl]-1H-1,2,4-triazole is an epoxy impurity of the antifungal agent Fluconazole .;Impurity in commercial preparations of Fluconazole |
| Molecular Formula | C11H9F2N3O |
| CAS# | 86386-76-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | FC1=C(C=CC(F)=C1)C2(CO2)CN3C=NC=N3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST18422.html |
| Additional Information | NULL |
