Casein Kinase II Inhibitor IV
Casein kinase II inhibitor IV is an effective small molecule inducer, which can be used to induce epidermal keratinocyte differentiation.
| Catalog Number | T10687 |
| Research Area | Metabolism|||Stem Cells |
| Molecular Formula | C24H23N5O3 |
| CAS# | 863598-09-8 |
| Purity | 98.81% |
| SMILES | COc1cc(Nc2nc(n(cc3)-c4cc(CCC#N)ccc4)c3cn2)cc(OC)c1OC |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/Casein Kinase II Inhibitor IV |
| Additional Information | https://www.targetmol.com/datasheet/T10687 |