Medetomidine Hydrochloride
An agonist of RECEPTORS, ADRENERGIC ALPHA-2 that is used in veterinary medicine for its analgesic and sedative properties. It is the racemate of DEXMEDETOMIDINE.
| Catalog Number | PIVA-0091 |
| Alternative Name(s) | Medetomidine HCl MPV785 106807-72-1 |
| Research Area | Vet API |
| Molecular Formula | C13H17ClN2 |
| CAS# | 86347-15-1 |
| SMILES | CC1=C(C(=CC=C1)C(C)C2=CN=CN2)C.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/medetomidine-hydrochloride-item-5819.html |