Medetomidine HCl 10mM * 1mL in DMSO
Medetomidine Hydrochloride is a synthetic drug used as both a surgical anesthetic and analgesic often used as the hydrochloride salt medetomidine hydrochloride.
| Trivial name | Medetomidine HCl 10mM * 1mL in DMSO |
| Catalog Number | A13775-10mM-D |
| Alternative Name(s) | 4-[1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole MonoHydrochloride |
| Molecular Formula | C13H16N2.HCl |
| CAS# | 86347-15-1 |
| SMILES | CC1=C(C(=CC=C1)C(C)C2=CN=CN2)C.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/medetomidine-hcl.html |