PSI-6206
PSI-6206, the deaminated derivative of PSI-6130, is a selective inhibitor of HCV NS5B polymerase and the EC50 for inhibition of HCV replicon is > 100 μM.
| Trivial name | Ro 2433 |
| Catalog Number | CSN12940 |
| Alternative Name(s) | Ro 2433 |
| Research Area | Infection |
| Molecular Formula | C10H13FN2O5 |
| CAS# | 863329-66-2 |
| Purity | ≥99% |
| SMILES | C[C@@]1(F)[C@H](O)[C@@H](CO)O[C@H]1N1C=CC(=O)NC1=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/psi-6206.html |