Cefodizime Sodium
Cefodizime Sodium is the sodium salt form of cefodizime, a third-generation, aminothiazolyl cephalosporin for parenteral use. Cefodizime has broad-spectrum activity and is stable to most beta-lactamases.
| Catalog Number | API86329795 |
| Alternative Name(s) | CEFODIZIME DISODIUM Cefodizime disodium salt THR-221 |
| Research Area | Antibacterial APIs |
| Molecular Formula | C20H18N6Na2O7S4 |
| CAS# | 86329-79-5 |
| SMILES | CC1=C(SC(=N1)SCC2=C(N3C(C(C3=O)NC(=O)C(=NOC)C4=CSC(=N4)N)SC2)C(=O)[O-])CC(=O)[O-].[Na+].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/cefodizime-sodium-item-11833.html |