A2764 2HCl
A2764 dihydrochloride is a selective inhibitor of TRESK (KCNK18) with an IC50 value of 11.8 μM. A2764 can inhibit TRESK in native cells, leading to cell depolarization and increased excitability.

Trivial name | / |
Catalog Number | CSN25279 |
Alternative Name(s) | / |
Research Area | Neurological Disease |
Molecular Formula | C15H21Cl3N2O |
CAS# | 861038-72-4 |
Purity | ≥99% |
SMILES | ClC1=C2C=CC=NC2=C(OCCN(CC)CC)C=C1.[H]Cl.[H]Cl |
Size | 5mg |
Supplier Page | https://www.csnpharm.com/products/a2764-2hcl.html |