AZD7762 25mg
AZD7762 is a potent ATP-competitive checkpoint kinase inhibitor that drives checkpoint abrogation and potentiates DNA-targeted therapies.
| Trivial name | AZD7762 25mg |
| Catalog Number | A10113-25 |
| Alternative Name(s) | 5-(3-Fluorophenyl)-3-ureidothiophene-N-[(S)-piperidin-3-yl]-2-carboxamide |
| Molecular Formula | C17H19FN4O2S |
| CAS# | 860352-01-8 |
| SMILES | C1C[C@@H](CNC1)NC(=O)C2=C(C=C(S2)C3=CC(=CC=C3)F)NC(=O)N |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/azd7762.html |
