9-Ethylcarbazole | MedChemExpress (MCE)

9-Ethylcarbazole (N-Ethylcarbazole) serves as a hydrogen storage material. The introduction of nitrogen (N) into 9-ethylcarbazole can reduce the endothermic nature of the reaction and decrease the dehydrogenation temperature, thereby facilitating the process of hydrogen storage and release[1].

Trivial name 9-Ethylcarbazole
Catalog Number HY-W015003
Alternative Name(s) N-Ethylcarbazole
Research Area Others
CAS# 86-28-2
Purity ≥98.0%
SMILES CCN1C2=C(C3=C1C=CC=C3)C=CC=C2
Size 25 g
Supplier Page https://www.medchemexpress.com/9-ethylcarbazole.html