Bafetinib 10mg
Bafetinib ((INNO-406) is a dual Bcr-Abl/Lyn tyrosine kinase inhibitor for the potential treatment of leukemia.
| Trivial name | Bafetinib 10mg |
| Catalog Number | A10119-10 |
| Alternative Name(s) | N-[3-([5,5'-Bipyrimidin]-2-ylamino)-4-methylphenyl]-4-[[(3S)-3-(dimethylamino)-1-pyrrolidinyl]methyl]-3-(trifluoromethyl)benzamide |
| Molecular Formula | C30H31F3N8O |
| CAS# | 859212-16-1 |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=C(C=C2)CN3CC[C@@H](C3)N(C)C)C(F)(F)F)NC4=NC=CC(=N4)C5=CN=CN=C5 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/bafetinib-inno-406.html |
