Lincomycin HCl
Lincomycin HCl is a lincosamide antibiotic that comes from the actinomycete Streptomyces lincolnensis, used to treat severe bacterial infections in people who cannot use penicillin antibiotics.

Trivial name | NSC 70731; U 10149A |
Catalog Number | CSN11303 |
Alternative Name(s) | NSC 70731; U 10149A |
Research Area | Infection |
Molecular Formula | C18H35ClN2O6S |
CAS# | 859-18-7 |
Purity | ≥99% |
SMILES | C[C@@H](O)[C@@]([C@@]([C@@H]([C@H](O)[C@H]1O)O)([H])O[C@@H]1SC)([H])NC([C@@H]2C[C@@H](CCC)CN2C)=O.Cl |
Size | 250mg |
Supplier Page | https://www.csnpharm.com/products/lincomycin-hcl.html |