Marsdenoside B | MedChemExpress (MCE)
Marsdenoside B (compound 8) is a Marsdenoside isolated from Alocasia genus. Marsdenoside B inhibits the growth of tumor cell lines MGC-803 and HT-29 with IC50s of 25.6 μg/mL and 32.4 μg/mL, respectively.
| Trivial name | Marsdenoside B |
| Catalog Number | HY-N12437 |
| Research Area | Cancer |
| CAS# | 858360-57-3 |
| Purity | ≥98.00% |
| SMILES | C[C@@]12[C@]3(CC[C@H]2C(C)=O)[C@]4([C@]([C@@]5([C@@](C[C@H](CC5)O[C@H]6C[C@H]([C@@H]([C@H](O6)C)O[C@H]7[C@@H]([C@@H]([C@@H]([C@H](O7)C)O)OC)O)OC)([H])CC4)C)([H])[C@@H]([C@H]1OC(/C(C)=C/C)=O)OC(/C(C)=C/C)=O)O3 |
| PubChem Chemical Structure ID | 101743838 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/marsdenoside-b.html |