Marsdenoside A | MedChemExpress (MCE)
Marsdenoside A (compound 7) is a Marsdenoside isolated from Alocasia genus. Marsdenoside A has a weak growth inhibitory effect on two tumor cell lines, MGC-803 and HT-29, with IC50 >50 μg/mL.
| Trivial name | Marsdenoside A |
| Catalog Number | HY-N12430 |
| Research Area | Cancer |
| CAS# | 858360-56-2 |
| Purity | ≥98.00% |
| SMILES | C[C@@]12[C@]3(CC[C@H]2C(C)=O)[C@]4([C@]([C@@]5([C@@](C[C@H](CC5)O[C@H]6C[C@H]([C@@H]([C@H](O6)C)O[C@H]7[C@@H]([C@@H]([C@@H]([C@H](O7)C)O)OC)O)OC)([H])CC4)C)([H])[C@@H]([C@H]1OC(/C(C)=C/C)=O)OC(C(C)CC)=O)O3 |
| PubChem Chemical Structure ID | 11228220 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/marsdenoside-a.html |