Motesanib Diphosphate 10mM * 1mL in DMSO
Motesanib, also known as AMG-706, is an orally administered multikinase inhibitor that selectively targets VEGF receptors, platelet-derived growth factor receptors, and Kit receptors.
| Trivial name | Motesanib Diphosphate 10mM * 1mL in DMSO |
| Catalog Number | A10608-10mM-D |
| Alternative Name(s) | N-(2,3-Dihydro-3,3-dimethyl-1H-indol-6-yl)-2-[(4-pyridinylmethyl)amino]-3-pyridinecarboxamide diphosphate |
| Molecular Formula | C22H23N5O.2H3PO4 |
| CAS# | 857876-30-3 |
| SMILES | CC1(CNC2=C1C=CC(=C2)NC(=O)C3=C(N=CC=C3)NCC4=CC=NC=C4)C.OP(=O)(O)O.OP(=O)(O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/motesanib-diphosphate.html |
