AT7867 10mM * 1mL in DMSO
AT7867 is a novel and potent inhibitor of both AKT and the downstream kinase p70 S6 kinase (p70S6K) and also of protein kinase A.
| Trivial name | AT7867 10mM * 1mL in DMSO |
| Catalog Number | A10094-10mM-D |
| Alternative Name(s) | 4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine |
| Molecular Formula | C20H20ClN3 |
| CAS# | 857531-00-1 |
| SMILES | C1CNCCC1(C2=CC=C(C=C2)C3=CNN=C3)C4=CC=C(C=C4)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/at7867.html |