(-)-Blebbistatin
(-)-Blebbistatin ((S)-(-)-Blebbistatin) is a cell-permeable inhibitor for non muscle myosin II ATPase with IC50 of ~2 μM in cell-free assays, does not inhibit myosin light chain kinase, inhibits contraction of the cleavage furrow without disrupting mitosis or contractile ring assembly.
| Trivial name | (S)-(-)-Blebbistatin |
| Catalog Number | S7099 |
| Molecular Formula | C18H16N2O2 |
| CAS# | 856925-71-8 |
| Inchi | InChI=1S/C18H16N2O2/c1-12-7-8-15-14(11-12)16(21)18(22)9-10-20(17(18)19-15)13-5-3-2-4-6-13/h2-8,11,22H,9-10H2,1H3/t18-/m1/s1 |
| Inchi Key | LZAXPYOBKSJSEX-GOSISDBHSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C3C(C2=O)(CCN3C4=CC=CC=C4)O |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/blebbistatin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Blebbistatin-chemical-structure-s7099.gif |