(-)-Blebbistcitin 50mg
Blebbistatin, a myosin II inhibitor, is photoinactivated by blue light.
| Trivial name | (-)-Blebbistcitin 50mg |
| Catalog Number | A13647-50 |
| Alternative Name(s) | 1,?2,?3,?3a-?tetrahydro-?3aS-?hydroxy-?6-?methyl-?1-?phenyl-?4H-?Pyrrolo[2,?3-?b]quinolin-?4-?one |
| Molecular Formula | C18H16N2O2 |
| CAS# | 856925-71-8 |
| SMILES | CC1=CC2=C(C=C1)N=C3[C@](C2=O)(CCN3C4=CC=CC=C4)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/blebbistcitin.html |
